Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-Amino-4-hydroxyanthraquinone, 96%
CAS: 116-85-8 Molecular Formula: C14H9NO3 Molecular Weight (g/mol): 239.23 MDL Number: MFCD00001223 InChI Key: AQXYVFBSOOBBQV-UHFFFAOYSA-N Synonym: 1-amino-4-hydroxyanthraquinone,disperse red 15,calcosyn pink b,celutate pink b,nacelan pink b,amacel pink b,celutate pink bn,celutate pink by,cibacete red 3b,disperse red 2s PubChem CID: 8323 IUPAC Name: 1-amino-4-hydroxyanthracene-9,10-dione SMILES: C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)O)N
| PubChem CID | 8323 |
|---|---|
| CAS | 116-85-8 |
| Molecular Weight (g/mol) | 239.23 |
| MDL Number | MFCD00001223 |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)O)N |
| Synonym | 1-amino-4-hydroxyanthraquinone,disperse red 15,calcosyn pink b,celutate pink b,nacelan pink b,amacel pink b,celutate pink bn,celutate pink by,cibacete red 3b,disperse red 2s |
| IUPAC Name | 1-amino-4-hydroxyanthracene-9,10-dione |
| InChI Key | AQXYVFBSOOBBQV-UHFFFAOYSA-N |
| Molecular Formula | C14H9NO3 |
4-(4-Methylpiperazino)acetophenone, 98%, Thermo Scientific™
CAS: 26586-55-0 Molecular Formula: C13H18N2O Molecular Weight (g/mol): 218.3 MDL Number: MFCD00023297 InChI Key: IRIZGAMYKHTLKS-UHFFFAOYSA-N Synonym: 1-4-4-methylpiperazino phenyl-1-ethanone,1-4-4-methylpiperazin-1-yl phenyl ethanone,p-4-methylpiperazino-acetophenone,acetophenone, 4'-4-methyl-1-piperazinyl,1-4-4-methylpiperazin-1-yl phenyl ethan-1-one,ethanone, 1-4-4-methyl-1-piperazinyl phenyl,ethanone,1-4-4-methyl-1-piperazinyl phenyl PubChem CID: 33551 IUPAC Name: 1-[4-(4-methylpiperazin-1-yl)phenyl]ethanone SMILES: CC(=O)C1=CC=C(C=C1)N2CCN(CC2)C
| PubChem CID | 33551 |
|---|---|
| CAS | 26586-55-0 |
| Molecular Weight (g/mol) | 218.3 |
| MDL Number | MFCD00023297 |
| SMILES | CC(=O)C1=CC=C(C=C1)N2CCN(CC2)C |
| Synonym | 1-4-4-methylpiperazino phenyl-1-ethanone,1-4-4-methylpiperazin-1-yl phenyl ethanone,p-4-methylpiperazino-acetophenone,acetophenone, 4'-4-methyl-1-piperazinyl,1-4-4-methylpiperazin-1-yl phenyl ethan-1-one,ethanone, 1-4-4-methyl-1-piperazinyl phenyl,ethanone,1-4-4-methyl-1-piperazinyl phenyl |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)phenyl]ethanone |
| InChI Key | IRIZGAMYKHTLKS-UHFFFAOYSA-N |
| Molecular Formula | C13H18N2O |
Methanesulfonic anhydride, 97%
CAS: 7143-01-3 Molecular Formula: C2H6O5S2 Molecular Weight (g/mol): 174.19 MDL Number: MFCD00007556 InChI Key: IZDROVVXIHRYMH-UHFFFAOYSA-N Synonym: methanesulfonic anhydride,methanesulfonic acid, anhydride,mesyl anhydride,mesic anhydride,methanesulphonic anhydride,methane sulfonic acid anhydride,methanesulfonyl methanesulfonate,methane sulfonic anhydride,methanesulfonic acid, 1,1'-anhydride,methanesulfonic acid methylsulfonyl ester PubChem CID: 81560 IUPAC Name: methylsulfonyl methanesulfonate SMILES: CS(=O)(=O)OS(=O)(=O)C
| PubChem CID | 81560 |
|---|---|
| CAS | 7143-01-3 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD00007556 |
| SMILES | CS(=O)(=O)OS(=O)(=O)C |
| Synonym | methanesulfonic anhydride,methanesulfonic acid, anhydride,mesyl anhydride,mesic anhydride,methanesulphonic anhydride,methane sulfonic acid anhydride,methanesulfonyl methanesulfonate,methane sulfonic anhydride,methanesulfonic acid, 1,1'-anhydride,methanesulfonic acid methylsulfonyl ester |
| IUPAC Name | methylsulfonyl methanesulfonate |
| InChI Key | IZDROVVXIHRYMH-UHFFFAOYSA-N |
| Molecular Formula | C2H6O5S2 |
2-Iodophenol, 98%
CAS: 533-58-4 Molecular Formula: C6H5IO Molecular Weight (g/mol): 220.01 MDL Number: MFCD00013963 InChI Key: KQDJTBPASNJQFQ-UHFFFAOYSA-N Synonym: o-iodophenol,phenol, 2-iodo,phenol, o-iodo,o-jodfenol,2-jodfenol,phenol, iodo,o-jodfenol czech,2-jodfenol czech,o-jodphenol,2-iodanylphenol PubChem CID: 10784 ChEBI: CHEBI:16706 IUPAC Name: 2-iodophenol SMILES: OC1=CC=CC=C1I
| PubChem CID | 10784 |
|---|---|
| CAS | 533-58-4 |
| Molecular Weight (g/mol) | 220.01 |
| ChEBI | CHEBI:16706 |
| MDL Number | MFCD00013963 |
| SMILES | OC1=CC=CC=C1I |
| Synonym | o-iodophenol,phenol, 2-iodo,phenol, o-iodo,o-jodfenol,2-jodfenol,phenol, iodo,o-jodfenol czech,2-jodfenol czech,o-jodphenol,2-iodanylphenol |
| IUPAC Name | 2-iodophenol |
| InChI Key | KQDJTBPASNJQFQ-UHFFFAOYSA-N |
| Molecular Formula | C6H5IO |
4-Methoxyphenylacetone, 97+%
CAS: 122-84-9 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.204 MDL Number: MFCD00008773 InChI Key: WFWKNGZODAOLEO-UHFFFAOYSA-N Synonym: 4-methoxyphenylacetone,p-acetonylanisole,anisketone,1-4-methoxyphenyl propan-2-one,2-propanone, 1-4-methoxyphenyl,anisyl methyl ketone,p-methoxyphenylacetone,4-methoxybenzyl methyl ketone,1-p-methoxyphenyl-2-propanone,anisic ketone PubChem CID: 31231 IUPAC Name: 1-(4-methoxyphenyl)propan-2-one SMILES: CC(=O)CC1=CC=C(C=C1)OC
| PubChem CID | 31231 |
|---|---|
| CAS | 122-84-9 |
| Molecular Weight (g/mol) | 164.204 |
| MDL Number | MFCD00008773 |
| SMILES | CC(=O)CC1=CC=C(C=C1)OC |
| Synonym | 4-methoxyphenylacetone,p-acetonylanisole,anisketone,1-4-methoxyphenyl propan-2-one,2-propanone, 1-4-methoxyphenyl,anisyl methyl ketone,p-methoxyphenylacetone,4-methoxybenzyl methyl ketone,1-p-methoxyphenyl-2-propanone,anisic ketone |
| IUPAC Name | 1-(4-methoxyphenyl)propan-2-one |
| InChI Key | WFWKNGZODAOLEO-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
2,4,6-Trimethylbenzoyl chloride, 98+%
CAS: 938-18-1 Molecular Formula: C10H11ClO Molecular Weight (g/mol): 182.647 MDL Number: MFCD00013650 InChI Key: UKRQMDIFLKHCRO-UHFFFAOYSA-N Synonym: mesitoyl chloride,benzoyl chloride, 2,4,6-trimethyl,2,4,6-trimethylbenzoylchloride,2,4,6-trimethyl-benzoyl chloride,pubchem13234,acmc-209rno,2-mesitylenecarbonyl chloride,ksc491c5b,2,4,6trimethylbenzoyl chloride,2,4,6-trimethylbenzoyl cloride PubChem CID: 97038 IUPAC Name: 2,4,6-trimethylbenzoyl chloride SMILES: CC1=CC(=C(C(=C1)C)C(=O)Cl)C
| PubChem CID | 97038 |
|---|---|
| CAS | 938-18-1 |
| Molecular Weight (g/mol) | 182.647 |
| MDL Number | MFCD00013650 |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)Cl)C |
| Synonym | mesitoyl chloride,benzoyl chloride, 2,4,6-trimethyl,2,4,6-trimethylbenzoylchloride,2,4,6-trimethyl-benzoyl chloride,pubchem13234,acmc-209rno,2-mesitylenecarbonyl chloride,ksc491c5b,2,4,6trimethylbenzoyl chloride,2,4,6-trimethylbenzoyl cloride |
| IUPAC Name | 2,4,6-trimethylbenzoyl chloride |
| InChI Key | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| Molecular Formula | C10H11ClO |
Methyl 3,4-diaminobenzoate, 98%
CAS: 36692-49-6 Molecular Formula: C8H10N2O2 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00017098 InChI Key: IOPLHGOSNCJOOO-UHFFFAOYSA-N Synonym: 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate PubChem CID: 135524 IUPAC Name: methyl 3,4-diaminobenzoate SMILES: COC(=O)C1=CC=C(N)C(N)=C1
| PubChem CID | 135524 |
|---|---|
| CAS | 36692-49-6 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00017098 |
| SMILES | COC(=O)C1=CC=C(N)C(N)=C1 |
| Synonym | 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate |
| IUPAC Name | methyl 3,4-diaminobenzoate |
| InChI Key | IOPLHGOSNCJOOO-UHFFFAOYSA-N |
| Molecular Formula | C8H10N2O2 |
4-Hydrazinobenzoic acid, 97%
CAS: 619-67-0 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.153 MDL Number: MFCD00007581 InChI Key: PCNFLKVWBDNNOW-UHFFFAOYSA-N Synonym: 4-hydrazinobenzoic acid,p-hydrazinobenzoic acid,benzoic acid, 4-hydrazino,p-carboxyphenylhydrazine,4-carboxyphenyl hydrazine,4-carboxyphenylhydrazine,4-hydrazino benzoic acid,benzoic acid, p-hydrazino,unii-b1r368je7o,ccris 7911 PubChem CID: 12089 IUPAC Name: 4-hydrazinylbenzoic acid SMILES: C1=CC(=CC=C1C(=O)O)NN
| PubChem CID | 12089 |
|---|---|
| CAS | 619-67-0 |
| Molecular Weight (g/mol) | 152.153 |
| MDL Number | MFCD00007581 |
| SMILES | C1=CC(=CC=C1C(=O)O)NN |
| Synonym | 4-hydrazinobenzoic acid,p-hydrazinobenzoic acid,benzoic acid, 4-hydrazino,p-carboxyphenylhydrazine,4-carboxyphenyl hydrazine,4-carboxyphenylhydrazine,4-hydrazino benzoic acid,benzoic acid, p-hydrazino,unii-b1r368je7o,ccris 7911 |
| IUPAC Name | 4-hydrazinylbenzoic acid |
| InChI Key | PCNFLKVWBDNNOW-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
2,2'-Furil, 98%
CAS: 492-94-4 Molecular Formula: C10H6O4 Molecular Weight (g/mol): 190.154 MDL Number: MFCD00003241 InChI Key: SXPUVBFQXJHYNS-UHFFFAOYSA-N Synonym: furil,alpha-furil,bipyromucyl,2,2'-furil,bipryomucyl,di-2-furylglyoxal,difuranylglyoxal,ethanedione, di-2-furanyl,di-2-furanylethanedione,a-furil PubChem CID: 68119 IUPAC Name: 1,2-bis(furan-2-yl)ethane-1,2-dione SMILES: C1=COC(=C1)C(=O)C(=O)C2=CC=CO2
| PubChem CID | 68119 |
|---|---|
| CAS | 492-94-4 |
| Molecular Weight (g/mol) | 190.154 |
| MDL Number | MFCD00003241 |
| SMILES | C1=COC(=C1)C(=O)C(=O)C2=CC=CO2 |
| Synonym | furil,alpha-furil,bipyromucyl,2,2'-furil,bipryomucyl,di-2-furylglyoxal,difuranylglyoxal,ethanedione, di-2-furanyl,di-2-furanylethanedione,a-furil |
| IUPAC Name | 1,2-bis(furan-2-yl)ethane-1,2-dione |
| InChI Key | SXPUVBFQXJHYNS-UHFFFAOYSA-N |
| Molecular Formula | C10H6O4 |
4-Nitrophenylacetonitrile, 98%
CAS: 555-21-5 Molecular Formula: C8H6N2O2 Molecular Weight (g/mol): 162.148 MDL Number: MFCD00007372 InChI Key: PXNJGLAVKOXITN-UHFFFAOYSA-N Synonym: 4-nitrophenylacetonitrile,p-nitrophenylacetonitrile,benzeneacetonitrile, 4-nitro,4-nitrobenzyl cyanide,2-4-nitrophenyl acetonitrile,p-nitrobenzyl cyanide,p-nitrobenzylcyanide,4-nitrobenzeneacetonitrile,acetonitrile, p-nitrophenyl,p-nitrophenyl acetonitrile PubChem CID: 68386 IUPAC Name: 2-(4-nitrophenyl)acetonitrile SMILES: C1=CC(=CC=C1CC#N)[N+](=O)[O-]
| PubChem CID | 68386 |
|---|---|
| CAS | 555-21-5 |
| Molecular Weight (g/mol) | 162.148 |
| MDL Number | MFCD00007372 |
| SMILES | C1=CC(=CC=C1CC#N)[N+](=O)[O-] |
| Synonym | 4-nitrophenylacetonitrile,p-nitrophenylacetonitrile,benzeneacetonitrile, 4-nitro,4-nitrobenzyl cyanide,2-4-nitrophenyl acetonitrile,p-nitrobenzyl cyanide,p-nitrobenzylcyanide,4-nitrobenzeneacetonitrile,acetonitrile, p-nitrophenyl,p-nitrophenyl acetonitrile |
| IUPAC Name | 2-(4-nitrophenyl)acetonitrile |
| InChI Key | PXNJGLAVKOXITN-UHFFFAOYSA-N |
| Molecular Formula | C8H6N2O2 |
2-Hydroxy-5-methoxybenzaldehyde, 98%
CAS: 672-13-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00003332 InChI Key: FZHSPPYCNDYIKD-UHFFFAOYSA-N Synonym: 5-methoxysalicylaldehyde,m-anisaldehyde, 6-hydroxy,benzaldehyde, 2-hydroxy-5-methoxy,salicylaldehyde, 5-methoxy,6-hydroxy-m-anisaldehyde,2-hydroxy-5-methoxy-benzaldehyde,5-methoxy-2-hydroxybenzaldehyde,2-hydroxy-5-methoxy benzaldehyde,2-formyl-4-methoxyphenol,pubchem2649 PubChem CID: 95695 IUPAC Name: 2-hydroxy-5-methoxybenzaldehyde SMILES: COC1=CC(=C(C=C1)O)C=O
| PubChem CID | 95695 |
|---|---|
| CAS | 672-13-9 |
| Molecular Weight (g/mol) | 152.149 |
| MDL Number | MFCD00003332 |
| SMILES | COC1=CC(=C(C=C1)O)C=O |
| Synonym | 5-methoxysalicylaldehyde,m-anisaldehyde, 6-hydroxy,benzaldehyde, 2-hydroxy-5-methoxy,salicylaldehyde, 5-methoxy,6-hydroxy-m-anisaldehyde,2-hydroxy-5-methoxy-benzaldehyde,5-methoxy-2-hydroxybenzaldehyde,2-hydroxy-5-methoxy benzaldehyde,2-formyl-4-methoxyphenol,pubchem2649 |
| IUPAC Name | 2-hydroxy-5-methoxybenzaldehyde |
| InChI Key | FZHSPPYCNDYIKD-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
9-Methylanthracene, 99%
CAS: 779-02-2 Molecular Formula: C15H12 Molecular Weight (g/mol): 192.26 MDL Number: MFCD00001261 InChI Key: CPGPAVAKSZHMBP-UHFFFAOYSA-N Synonym: anthracene, 9-methyl,unii-65nk4cin03,ccris 2740,9-methyl anthracene,9-methyl-anthracene,anthracen-9-ylmethyl,acmc-209pcm,9-methylanthracene,wln: l c666j b1,9-methylanthracene, analytical standard PubChem CID: 13068 IUPAC Name: 9-methylanthracene SMILES: CC1=C2C=CC=CC2=CC2=CC=CC=C12
| PubChem CID | 13068 |
|---|---|
| CAS | 779-02-2 |
| Molecular Weight (g/mol) | 192.26 |
| MDL Number | MFCD00001261 |
| SMILES | CC1=C2C=CC=CC2=CC2=CC=CC=C12 |
| Synonym | anthracene, 9-methyl,unii-65nk4cin03,ccris 2740,9-methyl anthracene,9-methyl-anthracene,anthracen-9-ylmethyl,acmc-209pcm,9-methylanthracene,wln: l c666j b1,9-methylanthracene, analytical standard |
| IUPAC Name | 9-methylanthracene |
| InChI Key | CPGPAVAKSZHMBP-UHFFFAOYSA-N |
| Molecular Formula | C15H12 |
2-Chloro-5-(trifluoromethyl)aniline, 97%
CAS: 121-50-6 Molecular Formula: C7H5ClF3N Molecular Weight (g/mol): 195.569 MDL Number: MFCD00007673 InChI Key: VKTTYIXIDXWHKW-UHFFFAOYSA-N Synonym: 3-amino-4-chlorobenzotrifluoride,2-chloro-5-trifluoromethyl aniline,fast orange rd oil,fast orange salt rd,orange salt nrd,benzenamine, 2-chloro-5-trifluoromethyl,fast orange rd salt,daito orange salt rd,diazo fast orange rd,fast orange salt rda PubChem CID: 8475 IUPAC Name: 2-chloro-5-(trifluoromethyl)aniline SMILES: C1=CC(=C(C=C1C(F)(F)F)N)Cl
| PubChem CID | 8475 |
|---|---|
| CAS | 121-50-6 |
| Molecular Weight (g/mol) | 195.569 |
| MDL Number | MFCD00007673 |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)Cl |
| Synonym | 3-amino-4-chlorobenzotrifluoride,2-chloro-5-trifluoromethyl aniline,fast orange rd oil,fast orange salt rd,orange salt nrd,benzenamine, 2-chloro-5-trifluoromethyl,fast orange rd salt,daito orange salt rd,diazo fast orange rd,fast orange salt rda |
| IUPAC Name | 2-chloro-5-(trifluoromethyl)aniline |
| InChI Key | VKTTYIXIDXWHKW-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClF3N |
Formaldehyde sodium bisulfite, 95%
CAS: 870-72-4 Molecular Formula: CH3NaO4S Molecular Weight (g/mol): 134.081 MDL Number: MFCD00044664 InChI Key: UOULCEYHQNCFFH-UHFFFAOYSA-M Synonym: sodium hydroxymethanesulfonate,formaldehyde sodium bisulfite,formbis,sodium formaldehyde bisulfite,sodium hydroxymethanesulphonate,methanesulfonic acid, hydroxy-, monosodium salt,sodium hydroxymethane sulfonate,sodium formaldehydebisulfite,unii-i566kha05f,methylolsulfonic acid sodium salt PubChem CID: 2723822 IUPAC Name: sodium;hydroxymethanesulfonate SMILES: C(O)S(=O)(=O)[O-].[Na+]
| PubChem CID | 2723822 |
|---|---|
| CAS | 870-72-4 |
| Molecular Weight (g/mol) | 134.081 |
| MDL Number | MFCD00044664 |
| SMILES | C(O)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium hydroxymethanesulfonate,formaldehyde sodium bisulfite,formbis,sodium formaldehyde bisulfite,sodium hydroxymethanesulphonate,methanesulfonic acid, hydroxy-, monosodium salt,sodium hydroxymethane sulfonate,sodium formaldehydebisulfite,unii-i566kha05f,methylolsulfonic acid sodium salt |
| IUPAC Name | sodium;hydroxymethanesulfonate |
| InChI Key | UOULCEYHQNCFFH-UHFFFAOYSA-M |
| Molecular Formula | CH3NaO4S |
2-Chloro-4-methoxyphenol, 97%
CAS: 18113-03-6 Molecular Formula: C7H7ClO2 Molecular Weight (g/mol): 158.581 MDL Number: MFCD00070773 InChI Key: GNVRRKLFFYSLGT-UHFFFAOYSA-N PubChem CID: 87459 IUPAC Name: 2-chloro-4-methoxyphenol SMILES: COC1=CC(=C(C=C1)O)Cl
| PubChem CID | 87459 |
|---|---|
| CAS | 18113-03-6 |
| Molecular Weight (g/mol) | 158.581 |
| MDL Number | MFCD00070773 |
| SMILES | COC1=CC(=C(C=C1)O)Cl |
| IUPAC Name | 2-chloro-4-methoxyphenol |
| InChI Key | GNVRRKLFFYSLGT-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2 |